C18H18N6O — CID 86802821
N-[3-(benzimidazol-1-yl)propyl]-3-(3-methyl-1,2,4-oxadiazol-5-yl)pyridin-2-amine (PubChem CID 86802821) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)propyl]-3-(3-methyl-1,2,4-oxadiazol-5-yl)pyridin-2-amine.
| Compound Name | N-[3-(benzimidazol-1-yl)propyl]-3-(3-methyl-1,2,4-oxadiazol-5-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 86802821 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)propyl]-3-(3-methyl-1,2,4-oxadiazol-5-yl)pyridin-2-amine |
| SMILES | Cc1noc(-c2cccnc2NCCCn2cnc3ccccc32)n1 |
| InChI | InChI=1S/C18H18N6O/c1-13-22-18(25-23-13)14-6-4-9-19-17(14)20-10-5-11-24-12-21-15-7-2-3-8-16(15)24/h2-4,6-9,12H,5,10-11H2,1H3,(H,19,20) |
| InChIKey | SUSWFNBPDLSEAT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|