About 2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide
2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide (PubChem CID 86802910) has the molecular formula C10H16N4O
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide.
Molecular Properties
| Compound Name | 2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide |
| PubChem CID | 86802910 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNc1ncc(C)c(C)n1 |
| InChI | InChI=1S/C10H16N4O/c1-4-11-9(15)6-13-10-12-5-7(2)8(3)14-10/h5H,4,6H2,1-3H3,(H,11,15)(H,12,13,14) |
| InChIKey | TWVLYFAMPYVJSO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide?
The IUPAC name of 2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide (CID 86802910) is 2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide.
What is the SMILES notation for 2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide?
The canonical SMILES for 2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide is CCNC(=O)CNc1ncc(C)c(C)n1.
What is the InChIKey of 2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide?
The InChIKey is TWVLYFAMPYVJSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O/c1-4-11-9(15)6-13-10-12-5-7(2)8(3)14-10/h5H,4,6H2,1-3H3,(H,11,15)(H,12,13,14).
What are the key properties of 2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide?
2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide has a molecular weight of 208.26 g/mol, XLogP of 0.64, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,5-dimethylpyrimidin-2-yl)amino]-N-ethylacetamide is sourced from PubChem (CID 86802910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).