C14H30N2O — CID 86804297
3,3-dimethyl-N-(3-morpholin-4-ylbutan-2-yl)butan-1-amine (PubChem CID 86804297) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 3,3-dimethyl-N-(3-morpholin-4-ylbutan-2-yl)butan-1-amine.
| Compound Name | 3,3-dimethyl-N-(3-morpholin-4-ylbutan-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 86804297 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 3,3-dimethyl-N-(3-morpholin-4-ylbutan-2-yl)butan-1-amine |
| SMILES | CC(NCCC(C)(C)C)C(C)N1CCOCC1 |
| InChI | InChI=1S/C14H30N2O/c1-12(15-7-6-14(3,4)5)13(2)16-8-10-17-11-9-16/h12-13,15H,6-11H2,1-5H3 |
| InChIKey | GUVFXDHNVQQVDS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |