About methyl 2-[3-(furan-2-ylmethylamino)-1,2,4-triazol-1-yl]acetate
methyl 2-[3-(furan-2-ylmethylamino)-1,2,4-triazol-1-yl]acetate (PubChem CID 86804435) has the molecular formula C10H12N4O3
and a molecular weight of 236.23 g/mol. Its IUPAC name is methyl 2-[3-(furan-2-ylmethylamino)-1,2,4-triazol-1-yl]acetate.
Analyze methyl 2-[3-(furan-2-ylmethylamino)-1,2,4-triazol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(furan-2-ylmethylamino)-1,2,4-triazol-1-yl]acetate?
The IUPAC name of methyl 2-[3-(furan-2-ylmethylamino)-1,2,4-triazol-1-yl]acetate (CID 86804435) is methyl 2-[3-(furan-2-ylmethylamino)-1,2,4-triazol-1-yl]acetate.
What is the SMILES notation for methyl 2-[3-(furan-2-ylmethylamino)-1,2,4-triazol-1-yl]acetate?
The canonical SMILES for methyl 2-[3-(furan-2-ylmethylamino)-1,2,4-triazol-1-yl]acetate is COC(=O)Cn1cnc(NCc2ccco2)n1.
What is the InChIKey of methyl 2-[3-(furan-2-ylmethylamino)-1,2,4-triazol-1-yl]acetate?
The InChIKey is UIRRYLHHGHAVSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O3/c1-16-9(15)6-14-7-12-10(13-14)11-5-8-3-2-4-17-8/h2-4,7H,5-6H2,1H3,(H,11,13).
What are the key properties of methyl 2-[3-(furan-2-ylmethylamino)-1,2,4-triazol-1-yl]acetate?
methyl 2-[3-(furan-2-ylmethylamino)-1,2,4-triazol-1-yl]acetate has a molecular weight of 236.23 g/mol, XLogP of 0.66, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(furan-2-ylmethylamino)-1,2,4-triazol-1-yl]acetate is sourced from PubChem (CID 86804435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).