About (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate
(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate (PubChem CID 86804807) has the molecular formula C16H13Br2N3O2
and a molecular weight of 439.11 g/mol. Its IUPAC name is (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate.
Molecular Properties
| Compound Name | (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate |
| PubChem CID | 86804807 |
| Molecular Formula | C16H13Br2N3O2 |
| Molecular Weight | 439.11 g/mol |
| Exact Mass | 436.94 |
| IUPAC Name | (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate |
| SMILES | Cc1ccc(CC(=O)OCc2nc3ncc(Br)cc3[nH]2)cc1Br |
| InChI | InChI=1S/C16H13Br2N3O2/c1-9-2-3-10(4-12(9)18)5-15(22)23-8-14-20-13-6-11(17)7-19-16(13)21-14/h2-4,6-7H,5,8H2,1H3,(H,19,20,21) |
| InChIKey | MGBFOEKCCBJFNR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.11 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate?
The IUPAC name of (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate (CID 86804807) is (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate.
What is the SMILES notation for (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate?
The canonical SMILES for (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate is Cc1ccc(CC(=O)OCc2nc3ncc(Br)cc3[nH]2)cc1Br.
What is the InChIKey of (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate?
The InChIKey is MGBFOEKCCBJFNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Br2N3O2/c1-9-2-3-10(4-12(9)18)5-15(22)23-8-14-20-13-6-11(17)7-19-16(13)21-14/h2-4,6-7H,5,8H2,1H3,(H,19,20,21).
What are the key properties of (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate?
(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate has a molecular weight of 439.11 g/mol, XLogP of 4.08, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)methyl 2-(3-bromo-4-methylphenyl)acetate is sourced from PubChem (CID 86804807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).