About N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine
N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine (PubChem CID 86804849) has the molecular formula C11H12Cl2N6
and a molecular weight of 299.16 g/mol. Its IUPAC name is N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine |
| PubChem CID | 86804849 |
| Molecular Formula | C11H12Cl2N6 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine |
| SMILES | Clc1cncnc1NCCCNc1ncncc1Cl |
| InChI | InChI=1S/C11H12Cl2N6/c12-8-4-14-6-18-10(8)16-2-1-3-17-11-9(13)5-15-7-19-11/h4-7H,1-3H2,(H,14,16,18)(H,15,17,19) |
| InChIKey | DQTMWKOGWMEMKK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine?
The IUPAC name of N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine (CID 86804849) is N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine.
What is the SMILES notation for N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine?
The canonical SMILES for N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine is Clc1cncnc1NCCCNc1ncncc1Cl.
What is the InChIKey of N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine?
The InChIKey is DQTMWKOGWMEMKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2N6/c12-8-4-14-6-18-10(8)16-2-1-3-17-11-9(13)5-15-7-19-11/h4-7H,1-3H2,(H,14,16,18)(H,15,17,19).
What are the key properties of N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine?
N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine has a molecular weight of 299.16 g/mol, XLogP of 2.49, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(5-chloropyrimidin-4-yl)propane-1,3-diamine is sourced from PubChem (CID 86804849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).