About N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide
N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide (PubChem CID 86805064) has the molecular formula C15H21F2N3O2
and a molecular weight of 313.35 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide.
Molecular Properties
| Compound Name | N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide |
| PubChem CID | 86805064 |
| Molecular Formula | C15H21F2N3O2 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide |
| SMILES | CC(C)N(CCN(C)C)C(=O)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H21F2N3O2/c1-10(2)20(9-8-19(3)4)15(22)14(21)18-13-11(16)6-5-7-12(13)17/h5-7,10H,8-9H2,1-4H3,(H,18,21) |
| InChIKey | SGGKJHMJJWMCKO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide?
The IUPAC name of N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide (CID 86805064) is N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide.
What is the SMILES notation for N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide?
The canonical SMILES for N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide is CC(C)N(CCN(C)C)C(=O)C(=O)Nc1c(F)cccc1F.
What is the InChIKey of N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide?
The InChIKey is SGGKJHMJJWMCKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2N3O2/c1-10(2)20(9-8-19(3)4)15(22)14(21)18-13-11(16)6-5-7-12(13)17/h5-7,10H,8-9H2,1-4H3,(H,18,21).
What are the key properties of N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide?
N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide has a molecular weight of 313.35 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-difluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-propan-2-yloxamide is sourced from PubChem (CID 86805064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).