C17H12F3N3O3 — CID 86805905
2,2,2-trifluoro-1-[5-(3-nitrophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 86805905) has the molecular formula C17H12F3N3O3 and a molecular weight of 363.30 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[5-(3-nitrophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[5-(3-nitrophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 86805905 |
| Molecular Formula | C17H12F3N3O3 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2,2,2-trifluoro-1-[5-(3-nitrophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | O=C(N1N=C(c2cccc([N+](=O)[O-])c2)CC1c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H12F3N3O3/c18-17(19,20)16(24)22-15(11-5-2-1-3-6-11)10-14(21-22)12-7-4-8-13(9-12)23(25)26/h1-9,15H,10H2 |
| InChIKey | GCWWSNSXTGXLTE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|