C20H20Cl2N2O3 — CID 86807544
1-(4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)-1-methyl-3-(3-prop-2-enoxyphenyl)urea (PubChem CID 86807544) has the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.30 g/mol. Its IUPAC name is 1-(4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)-1-methyl-3-(3-prop-2-enoxyphenyl)urea.
| Compound Name | 1-(4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)-1-methyl-3-(3-prop-2-enoxyphenyl)urea |
|---|---|
| PubChem CID | 86807544 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1-(4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)-1-methyl-3-(3-prop-2-enoxyphenyl)urea |
| SMILES | C=CCOc1cccc(NC(=O)N(C)C2c3cc(Cl)cc(Cl)c3CC2O)c1 |
| InChI | InChI=1S/C20H20Cl2N2O3/c1-3-7-27-14-6-4-5-13(10-14)23-20(26)24(2)19-16-8-12(21)9-17(22)15(16)11-18(19)25/h3-6,8-10,18-19,25H,1,7,11H2,2H3,(H,23,26) |
| InChIKey | KJSRXWRIOPLHHP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|