C17H23N5O3S — CID 86807593
N-[[1-(2-phenylethyl)imidazol-2-yl]methyl]-3-sulfamoylpyrrolidine-1-carboxamide (PubChem CID 86807593) has the molecular formula C17H23N5O3S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[[1-(2-phenylethyl)imidazol-2-yl]methyl]-3-sulfamoylpyrrolidine-1-carboxamide.
| Compound Name | N-[[1-(2-phenylethyl)imidazol-2-yl]methyl]-3-sulfamoylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 86807593 |
| Molecular Formula | C17H23N5O3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[[1-(2-phenylethyl)imidazol-2-yl]methyl]-3-sulfamoylpyrrolidine-1-carboxamide |
| SMILES | NS(=O)(=O)C1CCN(C(=O)NCc2nccn2CCc2ccccc2)C1 |
| InChI | InChI=1S/C17H23N5O3S/c18-26(24,25)15-7-10-22(13-15)17(23)20-12-16-19-8-11-21(16)9-6-14-4-2-1-3-5-14/h1-5,8,11,15H,6-7,9-10,12-13H2,(H,20,23)(H2,18,24,25) |
| InChIKey | NQNOOUISXWWSCJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |