C15H14ClNO5S — CID 86807747
4-chloro-3-[(4-hydroxyphenyl)-methylsulfamoyl]-5-methylbenzoic acid (PubChem CID 86807747) has the molecular formula C15H14ClNO5S and a molecular weight of 355.80 g/mol. Its IUPAC name is 4-chloro-3-[(4-hydroxyphenyl)-methylsulfamoyl]-5-methylbenzoic acid.
| Compound Name | 4-chloro-3-[(4-hydroxyphenyl)-methylsulfamoyl]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 86807747 |
| Molecular Formula | C15H14ClNO5S |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 4-chloro-3-[(4-hydroxyphenyl)-methylsulfamoyl]-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)N(C)c2ccc(O)cc2)c1Cl |
| InChI | InChI=1S/C15H14ClNO5S/c1-9-7-10(15(19)20)8-13(14(9)16)23(21,22)17(2)11-3-5-12(18)6-4-11/h3-8,18H,1-2H3,(H,19,20) |
| InChIKey | BTIRFNQWLBHAEX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |