About N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide
N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide (PubChem CID 86807912) has the molecular formula C12H21N5O
and a molecular weight of 251.33 g/mol. Its IUPAC name is N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide.
Molecular Properties
| Compound Name | N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide |
| PubChem CID | 86807912 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)NC(C)c1nnnn1C1CC1 |
| InChI | InChI=1S/C12H21N5O/c1-5-12(3,4)11(18)13-8(2)10-14-15-16-17(10)9-6-7-9/h8-9H,5-7H2,1-4H3,(H,13,18) |
| InChIKey | BPUYGPPLDMDMLL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide?
The IUPAC name of N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide (CID 86807912) is N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide.
What is the SMILES notation for N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide?
The canonical SMILES for N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide is CCC(C)(C)C(=O)NC(C)c1nnnn1C1CC1.
What is the InChIKey of N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide?
The InChIKey is BPUYGPPLDMDMLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O/c1-5-12(3,4)11(18)13-8(2)10-14-15-16-17(10)9-6-7-9/h8-9H,5-7H2,1-4H3,(H,13,18).
What are the key properties of N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide?
N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide has a molecular weight of 251.33 g/mol, XLogP of 1.62, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1-cyclopropyltetrazol-5-yl)ethyl]-2,2-dimethylbutanamide is sourced from PubChem (CID 86807912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).