C19H29N5O — CID 86808085
4-methyl-2-morpholin-4-yl-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]pentan-1-amine (PubChem CID 86808085) has the molecular formula C19H29N5O and a molecular weight of 343.47 g/mol. Its IUPAC name is 4-methyl-2-morpholin-4-yl-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]pentan-1-amine.
| Compound Name | 4-methyl-2-morpholin-4-yl-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 86808085 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 4-methyl-2-morpholin-4-yl-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]pentan-1-amine |
| SMILES | CC(C)CC(CNCc1cn[nH]c1-c1cccnc1)N1CCOCC1 |
| InChI | InChI=1S/C19H29N5O/c1-15(2)10-18(24-6-8-25-9-7-24)14-21-12-17-13-22-23-19(17)16-4-3-5-20-11-16/h3-5,11,13,15,18,21H,6-10,12,14H2,1-2H3,(H,22,23) |
| InChIKey | PFVWDFYZBPHVLW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |