C18H28N4O — CID 86808598
N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]-1-(2-methylpropyl)piperidin-4-amine (PubChem CID 86808598) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]-1-(2-methylpropyl)piperidin-4-amine.
| Compound Name | N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]-1-(2-methylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 86808598 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | N-[[5-(5-methylfuran-2-yl)-1H-pyrazol-4-yl]methyl]-1-(2-methylpropyl)piperidin-4-amine |
| SMILES | Cc1ccc(-c2[nH]ncc2CNC2CCN(CC(C)C)CC2)o1 |
| InChI | InChI=1S/C18H28N4O/c1-13(2)12-22-8-6-16(7-9-22)19-10-15-11-20-21-18(15)17-5-4-14(3)23-17/h4-5,11,13,16,19H,6-10,12H2,1-3H3,(H,20,21) |
| InChIKey | BTAWIEGNDOTGDF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |