C17H8F20O3S — CID 86809716
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl benzenesulfonate (PubChem CID 86809716) has the molecular formula C17H8F20O3S and a molecular weight of 672.27 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl benzenesulfonate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl benzenesulfonate |
|---|---|
| PubChem CID | 86809716 |
| Molecular Formula | C17H8F20O3S |
| Molecular Weight | 672.27 g/mol |
| Exact Mass | 671.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluoroundecyl benzenesulfonate |
| SMILES | O=S(=O)(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H8F20O3S/c18-8(19)10(22,23)12(26,27)14(30,31)16(34,35)17(36,37)15(32,33)13(28,29)11(24,25)9(20,21)6-40-41(38,39)7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | BZZHDGFVJWWOQD-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.27 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|