C17H24ClN5O2 — CID 86810332
2-[[3-chloropropylcarbamoyl(methyl)amino]methyl]-N,N,1-trimethylbenzimidazole-5-carboxamide (PubChem CID 86810332) has the molecular formula C17H24ClN5O2 and a molecular weight of 365.87 g/mol. Its IUPAC name is 2-[[3-chloropropylcarbamoyl(methyl)amino]methyl]-N,N,1-trimethylbenzimidazole-5-carboxamide.
| Compound Name | 2-[[3-chloropropylcarbamoyl(methyl)amino]methyl]-N,N,1-trimethylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 86810332 |
| Molecular Formula | C17H24ClN5O2 |
| Molecular Weight | 365.87 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-[[3-chloropropylcarbamoyl(methyl)amino]methyl]-N,N,1-trimethylbenzimidazole-5-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(c1)nc(CN(C)C(=O)NCCCCl)n2C |
| InChI | InChI=1S/C17H24ClN5O2/c1-21(2)16(24)12-6-7-14-13(10-12)20-15(23(14)4)11-22(3)17(25)19-9-5-8-18/h6-7,10H,5,8-9,11H2,1-4H3,(H,19,25) |
| InChIKey | QJJMLRFTZNMVGE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.87 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|