C9H9F2N3O2 — CID 86811016
2-(3,3-difluoropyrrolidin-1-yl)-3-nitropyridine (PubChem CID 86811016) has the molecular formula C9H9F2N3O2 and a molecular weight of 229.19 g/mol. Its IUPAC name is 2-(3,3-difluoropyrrolidin-1-yl)-3-nitropyridine.
| Compound Name | 2-(3,3-difluoropyrrolidin-1-yl)-3-nitropyridine |
|---|---|
| PubChem CID | 86811016 |
| Molecular Formula | C9H9F2N3O2 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-(3,3-difluoropyrrolidin-1-yl)-3-nitropyridine |
| SMILES | O=[N+]([O-])c1cccnc1N1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H9F2N3O2/c10-9(11)3-5-13(6-9)8-7(14(15)16)2-1-4-12-8/h1-2,4H,3,5-6H2 |
| InChIKey | KMNCCNUHBMTODK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|