About 3-(2-nitro-3-pyridinyl)-1,3-thiazolidine
3-(2-nitro-3-pyridinyl)-1,3-thiazolidine (PubChem CID 86811028) has the molecular formula C8H9N3O2S
and a molecular weight of 211.25 g/mol. Its IUPAC name is 3-(2-nitro-3-pyridinyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 3-(2-nitro-3-pyridinyl)-1,3-thiazolidine |
| PubChem CID | 86811028 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 3-(2-nitro-3-pyridinyl)-1,3-thiazolidine |
| SMILES | O=[N+]([O-])c1ncccc1N1CCSC1 |
| InChI | InChI=1S/C8H9N3O2S/c12-11(13)8-7(2-1-3-9-8)10-4-5-14-6-10/h1-3H,4-6H2 |
| InChIKey | HDRKUDSMTKSOPS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-nitro-3-pyridinyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-nitro-3-pyridinyl)-1,3-thiazolidine?
The IUPAC name of 3-(2-nitro-3-pyridinyl)-1,3-thiazolidine (CID 86811028) is 3-(2-nitro-3-pyridinyl)-1,3-thiazolidine.
What is the SMILES notation for 3-(2-nitro-3-pyridinyl)-1,3-thiazolidine?
The canonical SMILES for 3-(2-nitro-3-pyridinyl)-1,3-thiazolidine is O=[N+]([O-])c1ncccc1N1CCSC1.
What is the InChIKey of 3-(2-nitro-3-pyridinyl)-1,3-thiazolidine?
The InChIKey is HDRKUDSMTKSOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2S/c12-11(13)8-7(2-1-3-9-8)10-4-5-14-6-10/h1-3H,4-6H2.
What are the key properties of 3-(2-nitro-3-pyridinyl)-1,3-thiazolidine?
3-(2-nitro-3-pyridinyl)-1,3-thiazolidine has a molecular weight of 211.25 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-nitro-3-pyridinyl)-1,3-thiazolidine is sourced from PubChem (CID 86811028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).