About 2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile
2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile (PubChem CID 86811052) has the molecular formula C11H9BrF2N2
and a molecular weight of 287.11 g/mol. Its IUPAC name is 2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile |
| PubChem CID | 86811052 |
| Molecular Formula | C11H9BrF2N2 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile |
| SMILES | N#Cc1cc(N2CCC(F)(F)C2)ccc1Br |
| InChI | InChI=1S/C11H9BrF2N2/c12-10-2-1-9(5-8(10)6-15)16-4-3-11(13,14)7-16/h1-2,5H,3-4,7H2 |
| InChIKey | KHYHDMZLRKEDPO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile?
The IUPAC name of 2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile (CID 86811052) is 2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile.
What is the SMILES notation for 2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile?
The canonical SMILES for 2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile is N#Cc1cc(N2CCC(F)(F)C2)ccc1Br.
What is the InChIKey of 2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile?
The InChIKey is KHYHDMZLRKEDPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrF2N2/c12-10-2-1-9(5-8(10)6-15)16-4-3-11(13,14)7-16/h1-2,5H,3-4,7H2.
What are the key properties of 2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile?
2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile has a molecular weight of 287.11 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-(3,3-difluoropyrrolidin-1-yl)benzonitrile is sourced from PubChem (CID 86811052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).