About butan-2-ylhydrazine;dihydrate;hydrochloride
butan-2-ylhydrazine;dihydrate;hydrochloride (PubChem CID 86811571) has the molecular formula C4H17ClN2O2
and a molecular weight of 160.65 g/mol. Its IUPAC name is butan-2-ylhydrazine;dihydrate;hydrochloride.
Molecular Properties
| Compound Name | butan-2-ylhydrazine;dihydrate;hydrochloride |
| PubChem CID | 86811571 |
| Molecular Formula | C4H17ClN2O2 |
| Molecular Weight | 160.65 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | butan-2-ylhydrazine;dihydrate;hydrochloride |
| SMILES | CCC(C)NN.Cl.O.O |
| InChI | InChI=1S/C4H12N2.ClH.2H2O/c1-3-4(2)6-5;;;/h4,6H,3,5H2,1-2H3;1H;2*1H2 |
| InChIKey | WJPDTKICKSWDOO-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.65 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ylhydrazine;dihydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylhydrazine;dihydrate;hydrochloride?
The IUPAC name of butan-2-ylhydrazine;dihydrate;hydrochloride (CID 86811571) is butan-2-ylhydrazine;dihydrate;hydrochloride.
What is the SMILES notation for butan-2-ylhydrazine;dihydrate;hydrochloride?
The canonical SMILES for butan-2-ylhydrazine;dihydrate;hydrochloride is CCC(C)NN.Cl.O.O.
What is the InChIKey of butan-2-ylhydrazine;dihydrate;hydrochloride?
The InChIKey is WJPDTKICKSWDOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N2.ClH.2H2O/c1-3-4(2)6-5;;;/h4,6H,3,5H2,1-2H3;1H;2*1H2.
What are the key properties of butan-2-ylhydrazine;dihydrate;hydrochloride?
butan-2-ylhydrazine;dihydrate;hydrochloride has a molecular weight of 160.65 g/mol, XLogP of -0.98, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylhydrazine;dihydrate;hydrochloride is sourced from PubChem (CID 86811571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).