C11H10BrF3N2S — CID 86811771
4-methyl-5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-amine;hydrobromide (PubChem CID 86811771) has the molecular formula C11H10BrF3N2S and a molecular weight of 339.18 g/mol. Its IUPAC name is 4-methyl-5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-amine;hydrobromide.
| Compound Name | 4-methyl-5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-amine;hydrobromide |
|---|---|
| PubChem CID | 86811771 |
| Molecular Formula | C11H10BrF3N2S |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 4-methyl-5-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.Cc1nc(N)sc1Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H9F3N2S.BrH/c1-5-8(17-11(15)16-5)4-6-2-3-7(12)10(14)9(6)13;/h2-3H,4H2,1H3,(H2,15,16);1H |
| InChIKey | MPWBYPWGZTZLKQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|