C9H17F3N2O3 — CID 86811922
1,1-bis(2-methoxyethyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 86811922) has the molecular formula C9H17F3N2O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is 1,1-bis(2-methoxyethyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1,1-bis(2-methoxyethyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 86811922 |
| Molecular Formula | C9H17F3N2O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1,1-bis(2-methoxyethyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | COCCN(CCOC)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O3/c1-16-5-3-14(4-6-17-2)8(15)13-7-9(10,11)12/h3-7H2,1-2H3,(H,13,15) |
| InChIKey | NGWJUHDIBXEBLX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |