About 1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride
1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride (PubChem CID 86812140) has the molecular formula C8H17Cl2N3O
and a molecular weight of 242.15 g/mol. Its IUPAC name is 1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride.
Molecular Properties
| Compound Name | 1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride |
| PubChem CID | 86812140 |
| Molecular Formula | C8H17Cl2N3O |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1NCCNC12CCNCC2 |
| InChI | InChI=1S/C8H15N3O.2ClH/c12-7-8(11-6-5-10-7)1-3-9-4-2-8;;/h9,11H,1-6H2,(H,10,12);2*1H |
| InChIKey | OXFSLLMEPPTYDY-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride?
The IUPAC name of 1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride (CID 86812140) is 1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride.
What is the SMILES notation for 1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride?
The canonical SMILES for 1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride is Cl.Cl.O=C1NCCNC12CCNCC2.
What is the InChIKey of 1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride?
The InChIKey is OXFSLLMEPPTYDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O.2ClH/c12-7-8(11-6-5-10-7)1-3-9-4-2-8;;/h9,11H,1-6H2,(H,10,12);2*1H.
What are the key properties of 1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride?
1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride has a molecular weight of 242.15 g/mol, XLogP of -0.33, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,9-triazaspiro[5.5]undecan-5-one;dihydrochloride is sourced from PubChem (CID 86812140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).