C7H6N4O2 — CID 86812176
4-pyridin-4-yl-1,2,4-triazolidine-3,5-dione (PubChem CID 86812176) has the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. Its IUPAC name is 4-pyridin-4-yl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-pyridin-4-yl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 86812176 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 4-pyridin-4-yl-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH][nH]c(=O)n1-c1ccncc1 |
| InChI | InChI=1S/C7H6N4O2/c12-6-9-10-7(13)11(6)5-1-3-8-4-2-5/h1-4H,(H,9,12)(H,10,13) |
| InChIKey | GLLPTOIEZFIHHC-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |