About 4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride
4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride (PubChem CID 86812362) has the molecular formula C10H19Cl2N3
and a molecular weight of 252.19 g/mol. Its IUPAC name is 4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride.
Molecular Properties
| Compound Name | 4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride |
| PubChem CID | 86812362 |
| Molecular Formula | C10H19Cl2N3 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride |
| SMILES | Cc1nc(C2CCNCC2)[nH]c1C.Cl.Cl |
| InChI | InChI=1S/C10H17N3.2ClH/c1-7-8(2)13-10(12-7)9-3-5-11-6-4-9;;/h9,11H,3-6H2,1-2H3,(H,12,13);2*1H |
| InChIKey | BXBQCMJCGPCALV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride?
The IUPAC name of 4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride (CID 86812362) is 4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride.
What is the SMILES notation for 4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride?
The canonical SMILES for 4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride is Cc1nc(C2CCNCC2)[nH]c1C.Cl.Cl.
What is the InChIKey of 4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride?
The InChIKey is BXBQCMJCGPCALV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3.2ClH/c1-7-8(2)13-10(12-7)9-3-5-11-6-4-9;;/h9,11H,3-6H2,1-2H3,(H,12,13);2*1H.
What are the key properties of 4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride?
4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride has a molecular weight of 252.19 g/mol, XLogP of 2.34, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dimethyl-1H-imidazol-2-yl)piperidine;dihydrochloride is sourced from PubChem (CID 86812362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).