About (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride
(4-chloro-2,5-difluorophenyl)methanamine;hydrochloride (PubChem CID 86812399) has the molecular formula C7H7Cl2F2N
and a molecular weight of 214.04 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride |
| PubChem CID | 86812399 |
| Molecular Formula | C7H7Cl2F2N |
| Molecular Weight | 214.04 g/mol |
| Exact Mass | 212.99 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride |
| SMILES | Cl.NCc1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C7H6ClF2N.ClH/c8-5-2-6(9)4(3-11)1-7(5)10;/h1-2H,3,11H2;1H |
| InChIKey | ADMLZGNJDGYPKG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.04 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride?
The IUPAC name of (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride (CID 86812399) is (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride.
What is the SMILES notation for (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride?
The canonical SMILES for (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride is Cl.NCc1cc(F)c(Cl)cc1F.
What is the InChIKey of (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride?
The InChIKey is ADMLZGNJDGYPKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClF2N.ClH/c8-5-2-6(9)4(3-11)1-7(5)10;/h1-2H,3,11H2;1H.
What are the key properties of (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride?
(4-chloro-2,5-difluorophenyl)methanamine;hydrochloride has a molecular weight of 214.04 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-2,5-difluorophenyl)methanamine;hydrochloride is sourced from PubChem (CID 86812399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).