About [5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride
[5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride (PubChem CID 86812443) has the molecular formula C9H9BrClN3O
and a molecular weight of 290.55 g/mol. Its IUPAC name is [5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride |
| PubChem CID | 86812443 |
| Molecular Formula | C9H9BrClN3O |
| Molecular Weight | 290.55 g/mol |
| Exact Mass | 288.96 |
| IUPAC Name | [5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride |
| SMILES | Cl.NCc1noc(-c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C9H8BrN3O.ClH/c10-7-3-1-2-6(4-7)9-12-8(5-11)13-14-9;/h1-4H,5,11H2;1H |
| InChIKey | BFBYRUWWUGEUQB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride?
The IUPAC name of [5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride (CID 86812443) is [5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride.
What is the SMILES notation for [5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride?
The canonical SMILES for [5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride is Cl.NCc1noc(-c2cccc(Br)c2)n1.
What is the InChIKey of [5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride?
The InChIKey is BFBYRUWWUGEUQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN3O.ClH/c10-7-3-1-2-6(4-7)9-12-8(5-11)13-14-9;/h1-4H,5,11H2;1H.
What are the key properties of [5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride?
[5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride has a molecular weight of 290.55 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride is sourced from PubChem (CID 86812443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).