C9H11Cl2NO3 — CID 86812705
1-(2,2-dichlorocyclopropanecarbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 86812705) has the molecular formula C9H11Cl2NO3 and a molecular weight of 252.10 g/mol. Its IUPAC name is 1-(2,2-dichlorocyclopropanecarbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(2,2-dichlorocyclopropanecarbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 86812705 |
| Molecular Formula | C9H11Cl2NO3 |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 1-(2,2-dichlorocyclopropanecarbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(=O)C1CC1(Cl)Cl |
| InChI | InChI=1S/C9H11Cl2NO3/c10-9(11)4-5(9)7(13)12-3-1-2-6(12)8(14)15/h5-6H,1-4H2,(H,14,15) |
| InChIKey | UGPZJIDTZQNUFP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|