C23H31N2O3+ — CID 8681305
[2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl]-methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium (PubChem CID 8681305) has the molecular formula C23H31N2O3+ and a molecular weight of 383.51 g/mol. Its IUPAC name is [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl]-methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium.
| Compound Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl]-methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium |
|---|---|
| PubChem CID | 8681305 |
| Molecular Formula | C23H31N2O3+ |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl]-methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium |
| SMILES | CCOc1ccc(OCCNC(=O)C[NH+](C)[C@H]2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C23H30N2O3/c1-3-27-19-11-13-20(14-12-19)28-16-15-24-23(26)17-25(2)22-10-6-8-18-7-4-5-9-21(18)22/h4-5,7,9,11-14,22H,3,6,8,10,15-17H2,1-2H3,(H,24,26)/p+1/t22-/m0/s1 |
| InChIKey | WBZHGVHARZBEJL-QFIPXVFZSA-O |
| XLogP | 2.17 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|