C14H30IN3O — CID 86813294
1,3-diethyl-2-[(2-propan-2-yloxan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 86813294) has the molecular formula C14H30IN3O and a molecular weight of 383.32 g/mol. Its IUPAC name is 1,3-diethyl-2-[(2-propan-2-yloxan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1,3-diethyl-2-[(2-propan-2-yloxan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 86813294 |
| Molecular Formula | C14H30IN3O |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 1,3-diethyl-2-[(2-propan-2-yloxan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCNC(=NCC1CCCOC1C(C)C)NCC.I |
| InChI | InChI=1S/C14H29N3O.HI/c1-5-15-14(16-6-2)17-10-12-8-7-9-18-13(12)11(3)4;/h11-13H,5-10H2,1-4H3,(H2,15,16,17);1H |
| InChIKey | CRHDGUAGCTUBFP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|