About [4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone
[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone (PubChem CID 86813315) has the molecular formula C16H16ClN3O
and a molecular weight of 301.78 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone.
Molecular Properties
| Compound Name | [4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone |
| PubChem CID | 86813315 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CC=C(c3ccc(Cl)cc3)CC2)n[nH]1 |
| InChI | InChI=1S/C16H16ClN3O/c1-11-10-15(19-18-11)16(21)20-8-6-13(7-9-20)12-2-4-14(17)5-3-12/h2-6,10H,7-9H2,1H3,(H,18,19) |
| InChIKey | OCFITJAUBFFYRH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone?
The IUPAC name of [4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone (CID 86813315) is [4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone.
What is the SMILES notation for [4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone?
The canonical SMILES for [4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone is Cc1cc(C(=O)N2CC=C(c3ccc(Cl)cc3)CC2)n[nH]1.
What is the InChIKey of [4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone?
The InChIKey is OCFITJAUBFFYRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3O/c1-11-10-15(19-18-11)16(21)20-8-6-13(7-9-20)12-2-4-14(17)5-3-12/h2-6,10H,7-9H2,1H3,(H,18,19).
What are the key properties of [4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone?
[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone has a molecular weight of 301.78 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-(5-methyl-1H-pyrazol-3-yl)methanone is sourced from PubChem (CID 86813315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).