About N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine
N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine (PubChem CID 86814251) has the molecular formula C15H25N5
and a molecular weight of 275.40 g/mol. Its IUPAC name is N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine.
Molecular Properties
| Compound Name | N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine |
| PubChem CID | 86814251 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine |
| SMILES | Cc1nn(C(C)(C)C)c(C)c1CNCc1cn[nH]c1C |
| InChI | InChI=1S/C15H25N5/c1-10-13(8-17-18-10)7-16-9-14-11(2)19-20(12(14)3)15(4,5)6/h8,16H,7,9H2,1-6H3,(H,17,18) |
| InChIKey | JMCFXHHLYIXCKQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine?
The IUPAC name of N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine (CID 86814251) is N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine.
What is the SMILES notation for N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine?
The canonical SMILES for N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine is Cc1nn(C(C)(C)C)c(C)c1CNCc1cn[nH]c1C.
What is the InChIKey of N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine?
The InChIKey is JMCFXHHLYIXCKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N5/c1-10-13(8-17-18-10)7-16-9-14-11(2)19-20(12(14)3)15(4,5)6/h8,16H,7,9H2,1-6H3,(H,17,18).
What are the key properties of N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine?
N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine has a molecular weight of 275.40 g/mol, XLogP of 2.58, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)methyl]-1-(5-methyl-1H-pyrazol-4-yl)methanamine is sourced from PubChem (CID 86814251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).