About 2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide
2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide (PubChem CID 86814275) has the molecular formula C15H32IN3O
and a molecular weight of 397.35 g/mol. Its IUPAC name is 2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide.
Molecular Properties
| Compound Name | 2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide |
| PubChem CID | 86814275 |
| Molecular Formula | C15H32IN3O |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide |
| SMILES | CCN/C(=N/CC(C)(C)CC1CCOCC1)N(C)C.I |
| InChI | InChI=1S/C15H31N3O.HI/c1-6-16-14(18(4)5)17-12-15(2,3)11-13-7-9-19-10-8-13;/h13H,6-12H2,1-5H3,(H,16,17);1H |
| InChIKey | GVCHBSXLQUOZPG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide?
The IUPAC name of 2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide (CID 86814275) is 2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide.
What is the SMILES notation for 2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide?
The canonical SMILES for 2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide is CCN/C(=N/CC(C)(C)CC1CCOCC1)N(C)C.I.
What is the InChIKey of 2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide?
The InChIKey is GVCHBSXLQUOZPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3O.HI/c1-6-16-14(18(4)5)17-12-15(2,3)11-13-7-9-19-10-8-13;/h13H,6-12H2,1-5H3,(H,16,17);1H.
What are the key properties of 2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide?
2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide has a molecular weight of 397.35 g/mol, XLogP of 2.97, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dimethyl-3-(oxan-4-yl)propyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide is sourced from PubChem (CID 86814275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).