C17H21ClN4O2 — CID 86814390
N'-(6-chloro-2-cyclopropylpyrimidin-4-yl)-N-(3,5-dimethoxyphenyl)ethane-1,2-diamine (PubChem CID 86814390) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is N'-(6-chloro-2-cyclopropylpyrimidin-4-yl)-N-(3,5-dimethoxyphenyl)ethane-1,2-diamine.
| Compound Name | N'-(6-chloro-2-cyclopropylpyrimidin-4-yl)-N-(3,5-dimethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 86814390 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N'-(6-chloro-2-cyclopropylpyrimidin-4-yl)-N-(3,5-dimethoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1cc(NCCNc2cc(Cl)nc(C3CC3)n2)cc(OC)c1 |
| InChI | InChI=1S/C17H21ClN4O2/c1-23-13-7-12(8-14(9-13)24-2)19-5-6-20-16-10-15(18)21-17(22-16)11-3-4-11/h7-11,19H,3-6H2,1-2H3,(H,20,21,22) |
| InChIKey | GGUGISZIXHXMOY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|