About methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate
methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 86814445) has the molecular formula C16H23ClN2O4S
and a molecular weight of 374.89 g/mol. Its IUPAC name is methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate |
| PubChem CID | 86814445 |
| Molecular Formula | C16H23ClN2O4S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NC2CCC(C(=O)OC(C)(C)C)CC2)nc1Cl |
| InChI | InChI=1S/C16H23ClN2O4S/c1-16(2,3)23-13(20)9-5-7-10(8-6-9)18-15-19-12(17)11(24-15)14(21)22-4/h9-10H,5-8H2,1-4H3,(H,18,19) |
| InChIKey | PDHSMCTZVPFIIP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate?
The IUPAC name of methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate (CID 86814445) is methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate.
What is the SMILES notation for methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate?
The canonical SMILES for methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate is COC(=O)c1sc(NC2CCC(C(=O)OC(C)(C)C)CC2)nc1Cl.
What is the InChIKey of methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate?
The InChIKey is PDHSMCTZVPFIIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23ClN2O4S/c1-16(2,3)23-13(20)9-5-7-10(8-6-9)18-15-19-12(17)11(24-15)14(21)22-4/h9-10H,5-8H2,1-4H3,(H,18,19).
What are the key properties of methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate?
methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate has a molecular weight of 374.89 g/mol, XLogP of 3.90, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-chloro-2-[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 86814445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).