C19H28N2O3S2 — CID 8681460
[2-[[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 8681460) has the molecular formula C19H28N2O3S2 and a molecular weight of 396.58 g/mol. Its IUPAC name is [2-[[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8681460 |
| Molecular Formula | C19H28N2O3S2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [2-[[(1S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)N[C@H](c1ccc2c(c1)OCCO2)C(C)C |
| InChI | InChI=1S/C19H28N2O3S2/c1-5-21(6-2)19(25)26-12-17(22)20-18(13(3)4)14-7-8-15-16(11-14)24-10-9-23-15/h7-8,11,13,18H,5-6,9-10,12H2,1-4H3,(H,20,22)/t18-/m0/s1 |
| InChIKey | KTADGYMVEBHJGO-SFHVURJKSA-N |
| XLogP | 3.63 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|