C16H20BrN3S — CID 86814853
N-(3-bromophenyl)-N'-[1-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)ethyl]ethane-1,2-diamine (PubChem CID 86814853) has the molecular formula C16H20BrN3S and a molecular weight of 366.33 g/mol. Its IUPAC name is N-(3-bromophenyl)-N'-[1-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N-(3-bromophenyl)-N'-[1-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 86814853 |
| Molecular Formula | C16H20BrN3S |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-(3-bromophenyl)-N'-[1-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)ethyl]ethane-1,2-diamine |
| SMILES | CC(NCCNc1cccc(Br)c1)c1nc2c(s1)CCC2 |
| InChI | InChI=1S/C16H20BrN3S/c1-11(16-20-14-6-3-7-15(14)21-16)18-8-9-19-13-5-2-4-12(17)10-13/h2,4-5,10-11,18-19H,3,6-9H2,1H3 |
| InChIKey | XCJGTNIDYDSAEX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|