About 2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide
2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide (PubChem CID 86815457) has the molecular formula C15H14F2N4O2
and a molecular weight of 320.30 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide |
| PubChem CID | 86815457 |
| Molecular Formula | C15H14F2N4O2 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide |
| SMILES | COc1nccnc1NNC(=O)C1CC1c1c(F)cccc1F |
| InChI | InChI=1S/C15H14F2N4O2/c1-23-15-13(18-5-6-19-15)20-21-14(22)9-7-8(9)12-10(16)3-2-4-11(12)17/h2-6,8-9H,7H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | YSTQBHVNJHGMOZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide?
The IUPAC name of 2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide (CID 86815457) is 2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide.
What is the SMILES notation for 2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide?
The canonical SMILES for 2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide is COc1nccnc1NNC(=O)C1CC1c1c(F)cccc1F.
What is the InChIKey of 2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide?
The InChIKey is YSTQBHVNJHGMOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N4O2/c1-23-15-13(18-5-6-19-15)20-21-14(22)9-7-8(9)12-10(16)3-2-4-11(12)17/h2-6,8-9H,7H2,1H3,(H,18,20)(H,21,22).
What are the key properties of 2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide?
2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide has a molecular weight of 320.30 g/mol, XLogP of 2.01, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-N'-(3-methoxypyrazin-2-yl)cyclopropane-1-carbohydrazide is sourced from PubChem (CID 86815457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).