About (2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol
(2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol (PubChem CID 86816154) has the molecular formula C12H14BrN3O
and a molecular weight of 296.17 g/mol. Its IUPAC name is (2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol |
| PubChem CID | 86816154 |
| Molecular Formula | C12H14BrN3O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | (2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol |
| SMILES | CC[C@H](CO)Nc1ccnc2cc(Br)cnc12 |
| InChI | InChI=1S/C12H14BrN3O/c1-2-9(7-17)16-10-3-4-14-11-5-8(13)6-15-12(10)11/h3-6,9,17H,2,7H2,1H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | LDQZJEGQFOSTPU-SECBINFHSA-N |
| XLogP | 2.58 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol?
The IUPAC name of (2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol (CID 86816154) is (2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol.
What is the SMILES notation for (2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol?
The canonical SMILES for (2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol is CC[C@H](CO)Nc1ccnc2cc(Br)cnc12.
What is the InChIKey of (2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol?
The InChIKey is LDQZJEGQFOSTPU-SECBINFHSA-N. The full InChI is InChI=1S/C12H14BrN3O/c1-2-9(7-17)16-10-3-4-14-11-5-8(13)6-15-12(10)11/h3-6,9,17H,2,7H2,1H3,(H,14,16)/t9-/m1/s1.
What are the key properties of (2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol?
(2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol has a molecular weight of 296.17 g/mol, XLogP of 2.58, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(7-bromo-1,5-naphthyridin-4-yl)amino]butan-1-ol is sourced from PubChem (CID 86816154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).