About 2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate
2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate (PubChem CID 86816162) has the molecular formula C12H24N2O3
and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | 2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate |
| PubChem CID | 86816162 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate |
| SMILES | CC1CCCC(CO)N1CCOC(=O)N(C)C |
| InChI | InChI=1S/C12H24N2O3/c1-10-5-4-6-11(9-15)14(10)7-8-17-12(16)13(2)3/h10-11,15H,4-9H2,1-3H3 |
| InChIKey | ISQGCOZFVDVUON-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate?
The IUPAC name of 2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate (CID 86816162) is 2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate.
What is the SMILES notation for 2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate?
The canonical SMILES for 2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate is CC1CCCC(CO)N1CCOC(=O)N(C)C.
What is the InChIKey of 2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate?
The InChIKey is ISQGCOZFVDVUON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3/c1-10-5-4-6-11(9-15)14(10)7-8-17-12(16)13(2)3/h10-11,15H,4-9H2,1-3H3.
What are the key properties of 2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate?
2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate has a molecular weight of 244.33 g/mol, XLogP of 0.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(hydroxymethyl)-6-methylpiperidin-1-yl]ethyl N,N-dimethylcarbamate is sourced from PubChem (CID 86816162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).