About [1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol
[1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol (PubChem CID 86817089) has the molecular formula C15H16N4OS
and a molecular weight of 300.39 g/mol. Its IUPAC name is [1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol.
Molecular Properties
| Compound Name | [1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol |
| PubChem CID | 86817089 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | [1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol |
| SMILES | CCc1nnc(Cn2ccnc2C(O)c2ccccc2)s1 |
| InChI | InChI=1S/C15H16N4OS/c1-2-12-17-18-13(21-12)10-19-9-8-16-15(19)14(20)11-6-4-3-5-7-11/h3-9,14,20H,2,10H2,1H3 |
| InChIKey | QGNZHLOSHHLYHC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol?
The IUPAC name of [1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol (CID 86817089) is [1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol.
What is the SMILES notation for [1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol?
The canonical SMILES for [1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol is CCc1nnc(Cn2ccnc2C(O)c2ccccc2)s1.
What is the InChIKey of [1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol?
The InChIKey is QGNZHLOSHHLYHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4OS/c1-2-12-17-18-13(21-12)10-19-9-8-16-15(19)14(20)11-6-4-3-5-7-11/h3-9,14,20H,2,10H2,1H3.
What are the key properties of [1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol?
[1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol has a molecular weight of 300.39 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5-ethyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-yl]-phenylmethanol is sourced from PubChem (CID 86817089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).