About 2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide
2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide (PubChem CID 86817401) has the molecular formula C9H15F3N2O3
and a molecular weight of 256.22 g/mol. Its IUPAC name is 2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide |
| PubChem CID | 86817401 |
| Molecular Formula | C9H15F3N2O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide |
| SMILES | O=C(NOCCC(F)(F)F)N1CCCC1CO |
| InChI | InChI=1S/C9H15F3N2O3/c10-9(11,12)3-5-17-13-8(16)14-4-1-2-7(14)6-15/h7,15H,1-6H2,(H,13,16) |
| InChIKey | GTGRTAKLIGHNTF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide?
The IUPAC name of 2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide (CID 86817401) is 2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide.
What is the SMILES notation for 2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide?
The canonical SMILES for 2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide is O=C(NOCCC(F)(F)F)N1CCCC1CO.
What is the InChIKey of 2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide?
The InChIKey is GTGRTAKLIGHNTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O3/c10-9(11,12)3-5-17-13-8(16)14-4-1-2-7(14)6-15/h7,15H,1-6H2,(H,13,16).
What are the key properties of 2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide?
2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide has a molecular weight of 256.22 g/mol, XLogP of 1.04, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-N-(3,3,3-trifluoropropoxy)pyrrolidine-1-carboxamide is sourced from PubChem (CID 86817401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).