C13H16N2O2S2 — CID 86817569
N-(1-cyanocyclobutyl)-N-methyl-2-methylsulfanylbenzenesulfonamide (PubChem CID 86817569) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is N-(1-cyanocyclobutyl)-N-methyl-2-methylsulfanylbenzenesulfonamide.
| Compound Name | N-(1-cyanocyclobutyl)-N-methyl-2-methylsulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 86817569 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N-(1-cyanocyclobutyl)-N-methyl-2-methylsulfanylbenzenesulfonamide |
| SMILES | CSc1ccccc1S(=O)(=O)N(C)C1(C#N)CCC1 |
| InChI | InChI=1S/C13H16N2O2S2/c1-15(13(10-14)8-5-9-13)19(16,17)12-7-4-3-6-11(12)18-2/h3-4,6-7H,5,8-9H2,1-2H3 |
| InChIKey | AKLCPIZECWWZQN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |