About methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate
methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate (PubChem CID 86817676) has the molecular formula C15H26N2O5
and a molecular weight of 314.38 g/mol. Its IUPAC name is methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate |
| PubChem CID | 86817676 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate |
| SMILES | CCOC1CC(NC(=O)CNC(=O)CC)(C(=O)OC)C1(C)C |
| InChI | InChI=1S/C15H26N2O5/c1-6-11(18)16-9-12(19)17-15(13(20)21-5)8-10(22-7-2)14(15,3)4/h10H,6-9H2,1-5H3,(H,16,18)(H,17,19) |
| InChIKey | CCPMSFMNVVONCH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate?
The IUPAC name of methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate (CID 86817676) is methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate.
What is the SMILES notation for methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate?
The canonical SMILES for methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate is CCOC1CC(NC(=O)CNC(=O)CC)(C(=O)OC)C1(C)C.
What is the InChIKey of methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate?
The InChIKey is CCPMSFMNVVONCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O5/c1-6-11(18)16-9-12(19)17-15(13(20)21-5)8-10(22-7-2)14(15,3)4/h10H,6-9H2,1-5H3,(H,16,18)(H,17,19).
What are the key properties of methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate?
methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate has a molecular weight of 314.38 g/mol, XLogP of 0.38, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-ethoxy-2,2-dimethyl-1-[[2-(propanoylamino)acetyl]amino]cyclobutane-1-carboxylate is sourced from PubChem (CID 86817676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).