C16H20N6S — CID 86818810
N-[2-(4-methyl-1,2,4-triazol-3-yl)propyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 86818810) has the molecular formula C16H20N6S and a molecular weight of 328.45 g/mol. Its IUPAC name is N-[2-(4-methyl-1,2,4-triazol-3-yl)propyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)propyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 86818810 |
| Molecular Formula | C16H20N6S |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)propyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC(CNc1ncnc2sc3c(c12)CCCC3)c1nncn1C |
| InChI | InChI=1S/C16H20N6S/c1-10(15-21-20-9-22(15)2)7-17-14-13-11-5-3-4-6-12(11)23-16(13)19-8-18-14/h8-10H,3-7H2,1-2H3,(H,17,18,19) |
| InChIKey | HIDZCXNCMGGTSU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |