C22H36N2O4 — CID 86818971
N-(6,6-dimethoxy-2,2-dimethylhexyl)-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide (PubChem CID 86818971) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-(6,6-dimethoxy-2,2-dimethylhexyl)-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(6,6-dimethoxy-2,2-dimethylhexyl)-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 86818971 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | N-(6,6-dimethoxy-2,2-dimethylhexyl)-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide |
| SMILES | COC(CCCC(C)(C)CNC(=O)c1[nH]c2c(c1C)C(=O)CC(C)(C)C2)OC |
| InChI | InChI=1S/C22H36N2O4/c1-14-18-15(11-22(4,5)12-16(18)25)24-19(14)20(26)23-13-21(2,3)10-8-9-17(27-6)28-7/h17,24H,8-13H2,1-7H3,(H,23,26) |
| InChIKey | QIPIPZMMPSTJKT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|