About N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide
N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide (PubChem CID 86819319) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide.
Molecular Properties
| Compound Name | N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide |
| PubChem CID | 86819319 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide |
| SMILES | CCOC1CC(O)(CNC(=O)C2CCC2)C1(C)C |
| InChI | InChI=1S/C14H25NO3/c1-4-18-11-8-14(17,13(11,2)3)9-15-12(16)10-6-5-7-10/h10-11,17H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | FCWQMEKTUDGHDA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide?
The IUPAC name of N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide (CID 86819319) is N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide.
What is the SMILES notation for N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide?
The canonical SMILES for N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide is CCOC1CC(O)(CNC(=O)C2CCC2)C1(C)C.
What is the InChIKey of N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide?
The InChIKey is FCWQMEKTUDGHDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO3/c1-4-18-11-8-14(17,13(11,2)3)9-15-12(16)10-6-5-7-10/h10-11,17H,4-9H2,1-3H3,(H,15,16).
What are the key properties of N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide?
N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide has a molecular weight of 255.36 g/mol, XLogP of 1.47, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl)methyl]cyclobutanecarboxamide is sourced from PubChem (CID 86819319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).