About (2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate
(2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate (PubChem CID 86819413) has the molecular formula C12H13N5O5S
and a molecular weight of 339.33 g/mol. Its IUPAC name is (2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | (2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate |
| PubChem CID | 86819413 |
| Molecular Formula | C12H13N5O5S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | (2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate |
| SMILES | CCc1[nH]nc(C(=O)OCc2csc(NC(C)=O)n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N5O5S/c1-3-8-10(17(20)21)9(16-15-8)11(19)22-4-7-5-23-12(14-7)13-6(2)18/h5H,3-4H2,1-2H3,(H,15,16)(H,13,14,18) |
| InChIKey | FECOSFZVCVFLSF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate?
The IUPAC name of (2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate (CID 86819413) is (2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate.
What is the SMILES notation for (2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate?
The canonical SMILES for (2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate is CCc1[nH]nc(C(=O)OCc2csc(NC(C)=O)n2)c1[N+](=O)[O-].
What is the InChIKey of (2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate?
The InChIKey is FECOSFZVCVFLSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5O5S/c1-3-8-10(17(20)21)9(16-15-8)11(19)22-4-7-5-23-12(14-7)13-6(2)18/h5H,3-4H2,1-2H3,(H,15,16)(H,13,14,18).
What are the key properties of (2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate?
(2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate has a molecular weight of 339.33 g/mol, XLogP of 1.65, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetamido-1,3-thiazol-4-yl)methyl 5-ethyl-4-nitro-1H-pyrazole-3-carboxylate is sourced from PubChem (CID 86819413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).