C11H15F2N5O2S — CID 86819420
N'-(2,2-difluoroethyl)-N'-ethyl-N-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)ethane-1,2-diamine (PubChem CID 86819420) has the molecular formula C11H15F2N5O2S and a molecular weight of 319.34 g/mol. Its IUPAC name is N'-(2,2-difluoroethyl)-N'-ethyl-N-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)ethane-1,2-diamine.
| Compound Name | N'-(2,2-difluoroethyl)-N'-ethyl-N-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 86819420 |
| Molecular Formula | C11H15F2N5O2S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N'-(2,2-difluoroethyl)-N'-ethyl-N-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)ethane-1,2-diamine |
| SMILES | CCN(CCNc1nc2sccn2c1[N+](=O)[O-])CC(F)F |
| InChI | InChI=1S/C11H15F2N5O2S/c1-2-16(7-8(12)13)4-3-14-9-10(18(19)20)17-5-6-21-11(17)15-9/h5-6,8,14H,2-4,7H2,1H3 |
| InChIKey | AUGURKCGDSSZPF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|