About 6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide
6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide (PubChem CID 86819533) has the molecular formula C11H15BrN2O2S
and a molecular weight of 319.22 g/mol. Its IUPAC name is 6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide.
Molecular Properties
| Compound Name | 6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
| PubChem CID | 86819533 |
| Molecular Formula | C11H15BrN2O2S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C11H15BrN2O2S/c1-13(2)17(15,16)14-6-5-9-7-11(12)4-3-10(9)8-14/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | IQPRSIQTAZPMLU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide?
The IUPAC name of 6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide (CID 86819533) is 6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide.
What is the SMILES notation for 6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide?
The canonical SMILES for 6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide is CN(C)S(=O)(=O)N1CCc2cc(Br)ccc2C1.
What is the InChIKey of 6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide?
The InChIKey is IQPRSIQTAZPMLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2O2S/c1-13(2)17(15,16)14-6-5-9-7-11(12)4-3-10(9)8-14/h3-4,7H,5-6,8H2,1-2H3.
What are the key properties of 6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide?
6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide has a molecular weight of 319.22 g/mol, XLogP of 1.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide is sourced from PubChem (CID 86819533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).